C32H45N9O6 — CID 19954412
2-[[2-[[6-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 19954412) has the molecular formula C32H45N9O6 and a molecular weight of 651.77 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[6-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 19954412 |
| Molecular Formula | C32H45N9O6 |
| Molecular Weight | 651.77 g/mol |
| Exact Mass | 651.35 |
| IUPAC Name | 2-[[2-[[6-amino-2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | NCCCCC(NC(=O)C(N)Cc1ccc(O)cc1)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C32H45N9O6/c33-14-4-3-8-25(39-28(43)23(34)16-19-10-12-21(42)13-11-19)29(44)40-26(9-5-15-37-32(35)36)30(45)41-27(31(46)47)17-20-18-38-24-7-2-1-6-22(20)24/h1-2,6-7,10-13,18,23,25-27,38,42H,3-5,8-9,14-17,33-34H2,(H,39,43)(H,40,44)(H,41,45)(H,46,47)(H4,35,36,37) |
| InChIKey | BZYTUPXHEIJUCE-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 277.06 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.77 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|