C34H45N9O5 — CID 22703200
2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 22703200) has the molecular formula C34H45N9O5 and a molecular weight of 659.79 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 22703200 |
| Molecular Formula | C34H45N9O5 |
| Molecular Weight | 659.79 g/mol |
| Exact Mass | 659.35 |
| IUPAC Name | 2-[[2-[[2-[(2-amino-4-methylpentanoyl)amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | CC(C)CC(N)C(=O)NC(CCCN=C(N)N)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)NC(Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C34H45N9O5/c1-19(2)14-24(35)30(44)41-27(12-7-13-38-34(36)37)31(45)42-28(15-20-17-39-25-10-5-3-8-22(20)25)32(46)43-29(33(47)48)16-21-18-40-26-11-6-4-9-23(21)26/h3-6,8-11,17-19,24,27-29,39-40H,7,12-16,35H2,1-2H3,(H,41,44)(H,42,45)(H,43,46)(H,47,48)(H4,36,37,38) |
| InChIKey | WWRRVLQSEPUNJL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 246.60 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.79 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|