C26H43N5O5 — CID 18306543
2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]-3-methylbutanoic acid (PubChem CID 18306543) has the molecular formula C26H43N5O5 and a molecular weight of 505.66 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 18306543 |
| Molecular Formula | C26H43N5O5 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.33 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)CC(NC(=O)C(N)CCCCN)C(=O)NC(Cc1ccccc1)C(=O)NC(C(=O)O)C(C)C |
| InChI | InChI=1S/C26H43N5O5/c1-16(2)14-20(29-23(32)19(28)12-8-9-13-27)24(33)30-21(15-18-10-6-5-7-11-18)25(34)31-22(17(3)4)26(35)36/h5-7,10-11,16-17,19-22H,8-9,12-15,27-28H2,1-4H3,(H,29,32)(H,30,33)(H,31,34)(H,35,36) |
| InChIKey | LHVKCFYKYIOCAR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|