C24H39N5O5S — CID 18304168
2-[[2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid (PubChem CID 18304168) has the molecular formula C24H39N5O5S and a molecular weight of 509.67 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 18304168 |
| Molecular Formula | C24H39N5O5S |
| Molecular Weight | 509.67 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-phenylpropanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(Cc1ccccc1)NC(=O)C(CS)NC(=O)C(N)CCCCN)C(=O)O |
| InChI | InChI=1S/C24H39N5O5S/c1-15(2)12-19(24(33)34)28-22(31)18(13-16-8-4-3-5-9-16)27-23(32)20(14-35)29-21(30)17(26)10-6-7-11-25/h3-5,8-9,15,17-20,35H,6-7,10-14,25-26H2,1-2H3,(H,27,32)(H,28,31)(H,29,30)(H,33,34) |
| InChIKey | PYMAUCYEZPPXNA-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.67 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|