C21H41N5O5S — CID 18306357
2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]-4-methylpentanoic acid (PubChem CID 18306357) has the molecular formula C21H41N5O5S and a molecular weight of 475.66 g/mol. Its IUPAC name is 2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 18306357 |
| Molecular Formula | C21H41N5O5S |
| Molecular Weight | 475.66 g/mol |
| Exact Mass | 475.28 |
| IUPAC Name | 2-[[2-[[2-(2,6-diaminohexanoylamino)-4-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(CS)NC(=O)C(CC(C)C)NC(=O)C(N)CCCCN)C(=O)O |
| InChI | InChI=1S/C21H41N5O5S/c1-12(2)9-15(24-18(27)14(23)7-5-6-8-22)19(28)26-17(11-32)20(29)25-16(21(30)31)10-13(3)4/h12-17,32H,5-11,22-23H2,1-4H3,(H,24,27)(H,25,29)(H,26,28)(H,30,31) |
| InChIKey | WKCIFCDRPQBGFR-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.66 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|