C18H35N5O5S2 — CID 18258698
2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-4-methylpentanoyl]amino]hexanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18258698) has the molecular formula C18H35N5O5S2 and a molecular weight of 465.64 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-4-methylpentanoyl]amino]hexanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-4-methylpentanoyl]amino]hexanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18258698 |
| Molecular Formula | C18H35N5O5S2 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 2-[[6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-4-methylpentanoyl]amino]hexanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | CC(C)CC(NC(=O)C(N)CS)C(=O)NC(CCCCN)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C18H35N5O5S2/c1-10(2)7-13(22-15(24)11(20)8-29)17(26)21-12(5-3-4-6-19)16(25)23-14(9-30)18(27)28/h10-14,29-30H,3-9,19-20H2,1-2H3,(H,21,26)(H,22,24)(H,23,25)(H,27,28) |
| InChIKey | RXWREOYIIMSVDX-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|