C18H36N6O5S2 — CID 18259098
2-[[6-amino-2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]hexanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18259098) has the molecular formula C18H36N6O5S2 and a molecular weight of 480.66 g/mol. Its IUPAC name is 2-[[6-amino-2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]hexanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[6-amino-2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]hexanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18259098 |
| Molecular Formula | C18H36N6O5S2 |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 2-[[6-amino-2-[[6-amino-2-[(2-amino-3-sulfanylpropanoyl)amino]hexanoyl]amino]hexanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | NCCCCC(NC(=O)C(N)CS)C(=O)NC(CCCCN)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C18H36N6O5S2/c19-7-3-1-5-12(22-15(25)11(21)9-30)16(26)23-13(6-2-4-8-20)17(27)24-14(10-31)18(28)29/h11-14,30-31H,1-10,19-21H2,(H,22,25)(H,23,26)(H,24,27)(H,28,29) |
| InChIKey | ZGDUACIJIOFNEX-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 202.66 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|