C14H26N4O6S — CID 18219853
6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-4-carboxybutanoyl]amino]hexanoic acid (PubChem CID 18219853) has the molecular formula C14H26N4O6S and a molecular weight of 378.45 g/mol. Its IUPAC name is 6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-4-carboxybutanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-4-carboxybutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18219853 |
| Molecular Formula | C14H26N4O6S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 6-amino-2-[[2-[(2-amino-3-sulfanylpropanoyl)amino]-4-carboxybutanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CCC(=O)O)NC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C14H26N4O6S/c15-6-2-1-3-10(14(23)24)18-13(22)9(4-5-11(19)20)17-12(21)8(16)7-25/h8-10,25H,1-7,15-16H2,(H,17,21)(H,18,22)(H,19,20)(H,23,24) |
| InChIKey | MUZAUPFGPMMZSS-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|