C14H27N5O5S — CID 18220722
2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18220722) has the molecular formula C14H27N5O5S and a molecular weight of 377.47 g/mol. Its IUPAC name is 2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18220722 |
| Molecular Formula | C14H27N5O5S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | 2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | NCCCCC(NC(=O)C(N)CCC(N)=O)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C14H27N5O5S/c15-6-2-1-3-9(13(22)19-10(7-25)14(23)24)18-12(21)8(16)4-5-11(17)20/h8-10,25H,1-7,15-16H2,(H2,17,20)(H,18,21)(H,19,22)(H,23,24) |
| InChIKey | ATTWDCRXQNKRII-UHFFFAOYSA-N |
| XLogP | -2.31 |
| TPSA | 190.63 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|