C20H39N7O6S — CID 18481379
2-[[6-amino-2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]hexanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18481379) has the molecular formula C20H39N7O6S and a molecular weight of 505.64 g/mol. Its IUPAC name is 2-[[6-amino-2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]hexanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[6-amino-2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]hexanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18481379 |
| Molecular Formula | C20H39N7O6S |
| Molecular Weight | 505.64 g/mol |
| Exact Mass | 505.27 |
| IUPAC Name | 2-[[6-amino-2-[[6-amino-2-[(2,5-diamino-5-oxopentanoyl)amino]hexanoyl]amino]hexanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | NCCCCC(NC(=O)C(N)CCC(N)=O)C(=O)NC(CCCCN)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C20H39N7O6S/c21-9-3-1-5-13(25-17(29)12(23)7-8-16(24)28)18(30)26-14(6-2-4-10-22)19(31)27-15(11-34)20(32)33/h12-15,34H,1-11,21-23H2,(H2,24,28)(H,25,29)(H,26,30)(H,27,31)(H,32,33) |
| InChIKey | NEEFRVBHMHWFPS-UHFFFAOYSA-N |
| XLogP | -2.69 |
| TPSA | 245.75 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.64 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|