C18H33N7O7S — CID 22653806
6-amino-2-[[5-amino-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-sulfanylpropanoyl]amino]-5-oxopentanoyl]amino]hexanoic acid (PubChem CID 22653806) has the molecular formula C18H33N7O7S and a molecular weight of 491.57 g/mol. Its IUPAC name is 6-amino-2-[[5-amino-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-sulfanylpropanoyl]amino]-5-oxopentanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[5-amino-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-sulfanylpropanoyl]amino]-5-oxopentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 22653806 |
| Molecular Formula | C18H33N7O7S |
| Molecular Weight | 491.57 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | 6-amino-2-[[5-amino-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-sulfanylpropanoyl]amino]-5-oxopentanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CCC(N)=O)NC(=O)C(CS)NC(=O)C(N)CC(N)=O)C(=O)O |
| InChI | InChI=1S/C18H33N7O7S/c19-6-2-1-3-11(18(31)32)24-16(29)10(4-5-13(21)26)23-17(30)12(8-33)25-15(28)9(20)7-14(22)27/h9-12,33H,1-8,19-20H2,(H2,21,26)(H2,22,27)(H,23,30)(H,24,29)(H,25,28)(H,31,32) |
| InChIKey | AADJMTKLBFWONJ-UHFFFAOYSA-N |
| XLogP | -3.95 |
| TPSA | 262.82 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.57 |
| LogP ≤ 5 | -3.95 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|