C16H30N6O7S — CID 22658152
6-amino-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-hydroxypropanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid (PubChem CID 22658152) has the molecular formula C16H30N6O7S and a molecular weight of 450.52 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-hydroxypropanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-hydroxypropanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 22658152 |
| Molecular Formula | C16H30N6O7S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-hydroxypropanoyl]amino]-3-sulfanylpropanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CS)NC(=O)C(CO)NC(=O)C(N)CC(N)=O)C(=O)O |
| InChI | InChI=1S/C16H30N6O7S/c17-4-2-1-3-9(16(28)29)20-15(27)11(7-30)22-14(26)10(6-23)21-13(25)8(18)5-12(19)24/h8-11,23,30H,1-7,17-18H2,(H2,19,24)(H,20,27)(H,21,25)(H,22,26)(H,28,29) |
| InChIKey | AJFNQKAPRZVAKL-UHFFFAOYSA-N |
| XLogP | -4.22 |
| TPSA | 239.96 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | -4.22 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|