C17H32N6O7S — CID 18304204
5-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-hydroxypropanoyl]amino]-5-oxopentanoic acid (PubChem CID 18304204) has the molecular formula C17H32N6O7S and a molecular weight of 464.55 g/mol. Its IUPAC name is 5-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-hydroxypropanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-hydroxypropanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18304204 |
| Molecular Formula | C17H32N6O7S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 5-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-3-sulfanylpropanoyl]amino]-3-hydroxypropanoyl]amino]-5-oxopentanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CS)C(=O)NC(CO)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C17H32N6O7S/c18-6-2-1-3-9(19)14(26)23-12(8-31)16(28)22-11(7-24)15(27)21-10(17(29)30)4-5-13(20)25/h9-12,24,31H,1-8,18-19H2,(H2,20,25)(H,21,27)(H,22,28)(H,23,26)(H,29,30) |
| InChIKey | DOGOIRJUPVZSBD-UHFFFAOYSA-N |
| XLogP | -3.83 |
| TPSA | 239.96 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | -3.83 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|