C11H20N4O6S — CID 18220800
2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-hydroxypropanoyl]amino]-3-sulfanylpropanoic acid (PubChem CID 18220800) has the molecular formula C11H20N4O6S and a molecular weight of 336.37 g/mol. Its IUPAC name is 2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-hydroxypropanoyl]amino]-3-sulfanylpropanoic acid.
| Compound Name | 2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-hydroxypropanoyl]amino]-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 18220800 |
| Molecular Formula | C11H20N4O6S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-hydroxypropanoyl]amino]-3-sulfanylpropanoic acid |
| SMILES | NC(=O)CCC(N)C(=O)NC(CO)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C11H20N4O6S/c12-5(1-2-8(13)17)9(18)14-6(3-16)10(19)15-7(4-22)11(20)21/h5-7,16,22H,1-4,12H2,(H2,13,17)(H,14,18)(H,15,19)(H,20,21) |
| InChIKey | MFHVAWMMKZBSRQ-UHFFFAOYSA-N |
| XLogP | -3.44 |
| TPSA | 184.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|