C17H31N5O8S — CID 18308350
5-[(1-carboxy-2-sulfanylethyl)amino]-4-[[2-(2,6-diaminohexanoylamino)-3-hydroxypropanoyl]amino]-5-oxopentanoic acid (PubChem CID 18308350) has the molecular formula C17H31N5O8S and a molecular weight of 465.53 g/mol. Its IUPAC name is 5-[(1-carboxy-2-sulfanylethyl)amino]-4-[[2-(2,6-diaminohexanoylamino)-3-hydroxypropanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-[(1-carboxy-2-sulfanylethyl)amino]-4-[[2-(2,6-diaminohexanoylamino)-3-hydroxypropanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18308350 |
| Molecular Formula | C17H31N5O8S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | 5-[(1-carboxy-2-sulfanylethyl)amino]-4-[[2-(2,6-diaminohexanoylamino)-3-hydroxypropanoyl]amino]-5-oxopentanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CO)C(=O)NC(CCC(=O)O)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C17H31N5O8S/c18-6-2-1-3-9(19)14(26)21-11(7-23)16(28)20-10(4-5-13(24)25)15(27)22-12(8-31)17(29)30/h9-12,23,31H,1-8,18-19H2,(H,20,28)(H,21,26)(H,22,27)(H,24,25)(H,29,30) |
| InChIKey | OQSKOQVWVINNGN-UHFFFAOYSA-N |
| XLogP | -3.23 |
| TPSA | 234.17 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | -3.23 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|