C20H38N6O8 — CID 18304600
6-amino-2-[[2-[[4-carboxy-2-(2,6-diaminohexanoylamino)butanoyl]amino]-3-hydroxypropanoyl]amino]hexanoic acid (PubChem CID 18304600) has the molecular formula C20H38N6O8 and a molecular weight of 490.56 g/mol. Its IUPAC name is 6-amino-2-[[2-[[4-carboxy-2-(2,6-diaminohexanoylamino)butanoyl]amino]-3-hydroxypropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[4-carboxy-2-(2,6-diaminohexanoylamino)butanoyl]amino]-3-hydroxypropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18304600 |
| Molecular Formula | C20H38N6O8 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | 6-amino-2-[[2-[[4-carboxy-2-(2,6-diaminohexanoylamino)butanoyl]amino]-3-hydroxypropanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CCC(=O)O)C(=O)NC(CO)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C20H38N6O8/c21-9-3-1-5-12(23)17(30)24-13(7-8-16(28)29)18(31)26-15(11-27)19(32)25-14(20(33)34)6-2-4-10-22/h12-15,27H,1-11,21-23H2,(H,24,30)(H,25,32)(H,26,31)(H,28,29)(H,33,34) |
| InChIKey | SWTZABMWWCROSE-UHFFFAOYSA-N |
| XLogP | -3.03 |
| TPSA | 260.19 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | -3.03 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|