C18H31N5O10 — CID 22697287
2-[[2-[[6-amino-2-[(2-amino-4-carboxybutanoyl)amino]hexanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid (PubChem CID 22697287) has the molecular formula C18H31N5O10 and a molecular weight of 477.47 g/mol. Its IUPAC name is 2-[[2-[[6-amino-2-[(2-amino-4-carboxybutanoyl)amino]hexanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[6-amino-2-[(2-amino-4-carboxybutanoyl)amino]hexanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 22697287 |
| Molecular Formula | C18H31N5O10 |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 2-[[2-[[6-amino-2-[(2-amino-4-carboxybutanoyl)amino]hexanoyl]amino]-3-hydroxypropanoyl]amino]butanedioic acid |
| SMILES | NCCCCC(NC(=O)C(N)CCC(=O)O)C(=O)NC(CO)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H31N5O10/c19-6-2-1-3-10(21-15(29)9(20)4-5-13(25)26)16(30)23-12(8-24)17(31)22-11(18(32)33)7-14(27)28/h9-12,24H,1-8,19-20H2,(H,21,29)(H,22,31)(H,23,30)(H,25,26)(H,27,28)(H,32,33) |
| InChIKey | XSPNCSQYRZSXMW-UHFFFAOYSA-N |
| XLogP | -3.69 |
| TPSA | 271.47 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|