C21H38N6O9 — CID 22697062
6-amino-2-[[2-[[6-amino-2-[(2-amino-4-carboxybutanoyl)amino]hexanoyl]amino]-3-carboxypropanoyl]amino]hexanoic acid (PubChem CID 22697062) has the molecular formula C21H38N6O9 and a molecular weight of 518.57 g/mol. Its IUPAC name is 6-amino-2-[[2-[[6-amino-2-[(2-amino-4-carboxybutanoyl)amino]hexanoyl]amino]-3-carboxypropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[6-amino-2-[(2-amino-4-carboxybutanoyl)amino]hexanoyl]amino]-3-carboxypropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 22697062 |
| Molecular Formula | C21H38N6O9 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | 6-amino-2-[[2-[[6-amino-2-[(2-amino-4-carboxybutanoyl)amino]hexanoyl]amino]-3-carboxypropanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CC(=O)O)NC(=O)C(CCCCN)NC(=O)C(N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C21H38N6O9/c22-9-3-1-5-13(25-18(32)12(24)7-8-16(28)29)19(33)27-15(11-17(30)31)20(34)26-14(21(35)36)6-2-4-10-23/h12-15H,1-11,22-24H2,(H,25,32)(H,26,34)(H,27,33)(H,28,29)(H,30,31)(H,35,36) |
| InChIKey | JAHGHILHUJZLNV-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 277.26 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|