C18H31N5O9S — CID 18264118
6-amino-2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-sulfanylpropanoyl]amino]-3-carboxypropanoyl]amino]hexanoic acid (PubChem CID 18264118) has the molecular formula C18H31N5O9S and a molecular weight of 493.54 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-sulfanylpropanoyl]amino]-3-carboxypropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-sulfanylpropanoyl]amino]-3-carboxypropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18264118 |
| Molecular Formula | C18H31N5O9S |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-amino-4-carboxybutanoyl)amino]-3-sulfanylpropanoyl]amino]-3-carboxypropanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CC(=O)O)NC(=O)C(CS)NC(=O)C(N)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H31N5O9S/c19-6-2-1-3-10(18(31)32)21-16(29)11(7-14(26)27)22-17(30)12(8-33)23-15(28)9(20)4-5-13(24)25/h9-12,33H,1-8,19-20H2,(H,21,29)(H,22,30)(H,23,28)(H,24,25)(H,26,27)(H,31,32) |
| InChIKey | OOLLCGSJKZPZIJ-UHFFFAOYSA-N |
| XLogP | -2.75 |
| TPSA | 251.24 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | -2.75 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|