C17H29N5O10 — CID 18308309
2-[[3-carboxy-2-[[2-(2,6-diaminohexanoylamino)-3-hydroxypropanoyl]amino]propanoyl]amino]butanedioic acid (PubChem CID 18308309) has the molecular formula C17H29N5O10 and a molecular weight of 463.44 g/mol. Its IUPAC name is 2-[[3-carboxy-2-[[2-(2,6-diaminohexanoylamino)-3-hydroxypropanoyl]amino]propanoyl]amino]butanedioic acid.
| Compound Name | 2-[[3-carboxy-2-[[2-(2,6-diaminohexanoylamino)-3-hydroxypropanoyl]amino]propanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18308309 |
| Molecular Formula | C17H29N5O10 |
| Molecular Weight | 463.44 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 2-[[3-carboxy-2-[[2-(2,6-diaminohexanoylamino)-3-hydroxypropanoyl]amino]propanoyl]amino]butanedioic acid |
| SMILES | NCCCCC(N)C(=O)NC(CO)C(=O)NC(CC(=O)O)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H29N5O10/c18-4-2-1-3-8(19)14(28)22-11(7-23)16(30)20-9(5-12(24)25)15(29)21-10(17(31)32)6-13(26)27/h8-11,23H,1-7,18-19H2,(H,20,30)(H,21,29)(H,22,28)(H,24,25)(H,26,27)(H,31,32) |
| InChIKey | INVAZEWVVQFHAE-UHFFFAOYSA-N |
| XLogP | -4.08 |
| TPSA | 271.47 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.44 |
| LogP ≤ 5 | -4.08 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|