C19H36N6O8 — CID 18308469
2-[[6-amino-2-[[2-(2,6-diaminohexanoylamino)-3-hydroxypropanoyl]amino]hexanoyl]amino]butanedioic acid (PubChem CID 18308469) has the molecular formula C19H36N6O8 and a molecular weight of 476.53 g/mol. Its IUPAC name is 2-[[6-amino-2-[[2-(2,6-diaminohexanoylamino)-3-hydroxypropanoyl]amino]hexanoyl]amino]butanedioic acid.
| Compound Name | 2-[[6-amino-2-[[2-(2,6-diaminohexanoylamino)-3-hydroxypropanoyl]amino]hexanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18308469 |
| Molecular Formula | C19H36N6O8 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | 2-[[6-amino-2-[[2-(2,6-diaminohexanoylamino)-3-hydroxypropanoyl]amino]hexanoyl]amino]butanedioic acid |
| SMILES | NCCCCC(N)C(=O)NC(CO)C(=O)NC(CCCCN)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H36N6O8/c20-7-3-1-5-11(22)16(29)25-14(10-26)18(31)23-12(6-2-4-8-21)17(30)24-13(19(32)33)9-15(27)28/h11-14,26H,1-10,20-22H2,(H,23,31)(H,24,30)(H,25,29)(H,27,28)(H,32,33) |
| InChIKey | SNYPRPJFAHHMIN-UHFFFAOYSA-N |
| XLogP | -3.42 |
| TPSA | 260.19 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | -3.42 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|