C18H36N6O7 — CID 18308557
6-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-3-hydroxypropanoyl]amino]-3-hydroxypropanoyl]amino]hexanoic acid (PubChem CID 18308557) has the molecular formula C18H36N6O7 and a molecular weight of 448.52 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-3-hydroxypropanoyl]amino]-3-hydroxypropanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-3-hydroxypropanoyl]amino]-3-hydroxypropanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18308557 |
| Molecular Formula | C18H36N6O7 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | 6-amino-2-[[2-[[2-(2,6-diaminohexanoylamino)-3-hydroxypropanoyl]amino]-3-hydroxypropanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CO)C(=O)NC(CO)C(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C18H36N6O7/c19-7-3-1-5-11(21)15(27)23-13(9-25)17(29)24-14(10-26)16(28)22-12(18(30)31)6-2-4-8-20/h11-14,25-26H,1-10,19-21H2,(H,22,28)(H,23,27)(H,24,29)(H,30,31) |
| InChIKey | IRSDWUNDJGMVLX-UHFFFAOYSA-N |
| XLogP | -3.90 |
| TPSA | 243.12 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | -3.90 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|