C11H24N4O3 — CID 71340044
5-amino-2-(2,6-diaminohexanoylamino)pentanoic acid (PubChem CID 71340044) has the molecular formula C11H24N4O3 and a molecular weight of 260.34 g/mol. Its IUPAC name is 5-amino-2-(2,6-diaminohexanoylamino)pentanoic acid.
| Compound Name | 5-amino-2-(2,6-diaminohexanoylamino)pentanoic acid |
|---|---|
| PubChem CID | 71340044 |
| Molecular Formula | C11H24N4O3 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 5-amino-2-(2,6-diaminohexanoylamino)pentanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CCCN)C(=O)O |
| InChI | InChI=1S/C11H24N4O3/c12-6-2-1-4-8(14)10(16)15-9(11(17)18)5-3-7-13/h8-9H,1-7,12-14H2,(H,15,16)(H,17,18) |
| InChIKey | FNTNTMPEEZFWOQ-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 144.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|