C9H23Cl3N4O3 — CID 11949492
(2S)-6-amino-2-[[(2R)-2,3-diaminopropanoyl]amino]hexanoic acid;trihydrochloride (PubChem CID 11949492) has the molecular formula C9H23Cl3N4O3 and a molecular weight of 341.67 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2R)-2,3-diaminopropanoyl]amino]hexanoic acid;trihydrochloride.
| Compound Name | (2S)-6-amino-2-[[(2R)-2,3-diaminopropanoyl]amino]hexanoic acid;trihydrochloride |
|---|---|
| PubChem CID | 11949492 |
| Molecular Formula | C9H23Cl3N4O3 |
| Molecular Weight | 341.67 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | (2S)-6-amino-2-[[(2R)-2,3-diaminopropanoyl]amino]hexanoic acid;trihydrochloride |
| SMILES | Cl.Cl.Cl.NCCCC[C@H](NC(=O)[C@H](N)CN)C(=O)O |
| InChI | InChI=1S/C9H20N4O3.3ClH/c10-4-2-1-3-7(9(15)16)13-8(14)6(12)5-11;;;/h6-7H,1-5,10-12H2,(H,13,14)(H,15,16);3*1H/t6-,7+;;;/m1.../s1 |
| InChIKey | CKBQYIYTIVWTLS-YEIXYONGSA-N |
| XLogP | -0.76 |
| TPSA | 144.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.67 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|