C13H27N3O3 — CID 118056357
(2S)-6-amino-2-[[(2S)-6-amino-2-methylhexanoyl]amino]hexanoic acid (PubChem CID 118056357) has the molecular formula C13H27N3O3 and a molecular weight of 273.38 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-6-amino-2-methylhexanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-6-amino-2-methylhexanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 118056357 |
| Molecular Formula | C13H27N3O3 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-6-amino-2-methylhexanoyl]amino]hexanoic acid |
| SMILES | C[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C13H27N3O3/c1-10(6-2-4-8-14)12(17)16-11(13(18)19)7-3-5-9-15/h10-11H,2-9,14-15H2,1H3,(H,16,17)(H,18,19)/t10-,11-/m0/s1 |
| InChIKey | BILKECPXYIMKIP-QWRGUYRKSA-N |
| XLogP | 0.45 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|