C11H21N3O5 — CID 22804605
(2S)-6-amino-2-[[4-(hydroxyamino)-2-methyl-4-oxobutanoyl]amino]hexanoic acid (PubChem CID 22804605) has the molecular formula C11H21N3O5 and a molecular weight of 275.31 g/mol. Its IUPAC name is (2S)-6-amino-2-[[4-(hydroxyamino)-2-methyl-4-oxobutanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[4-(hydroxyamino)-2-methyl-4-oxobutanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 22804605 |
| Molecular Formula | C11H21N3O5 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (2S)-6-amino-2-[[4-(hydroxyamino)-2-methyl-4-oxobutanoyl]amino]hexanoic acid |
| SMILES | CC(CC(=O)NO)C(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C11H21N3O5/c1-7(6-9(15)14-19)10(16)13-8(11(17)18)4-2-3-5-12/h7-8,19H,2-6,12H2,1H3,(H,13,16)(H,14,15)(H,17,18)/t7?,8-/m0/s1 |
| InChIKey | BXVNPAPUNVGWKM-MQWKRIRWSA-N |
| XLogP | -0.78 |
| TPSA | 141.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|