(2R)-6-amino-2-(hydroxyamino)hexanoic acid

C6H14N2O3 — CID 87193141

IUPAC(2R)-6-amino-2-(hydroxyamino)hexanoic acid
SMILESNCCCC[C@@H](NO)C(=O)O
InChIInChI=1S/C6H14N2O3/c7-4-2-1-3-5(8-11)6(9)10/h5,8,11H,1-4,7H2,(H,9,10)/t5-/m1/s1
InChIKeyQJHBJHUKURJDLG-RXMQYKEDSA-N
MW162.19 g/mol
LogP-0.45
Rot. Bonds6

About (2R)-6-amino-2-(hydroxyamino)hexanoic acid

(2R)-6-amino-2-(hydroxyamino)hexanoic acid (PubChem CID 87193141) has the molecular formula C6H14N2O3 and a molecular weight of 162.19 g/mol. Its IUPAC name is (2R)-6-amino-2-(hydroxyamino)hexanoic acid.

Molecular Properties

Compound Name(2R)-6-amino-2-(hydroxyamino)hexanoic acid
PubChem CID87193141
Molecular FormulaC6H14N2O3
Molecular Weight162.19 g/mol
Exact Mass162.10
IUPAC Name(2R)-6-amino-2-(hydroxyamino)hexanoic acid
SMILESNCCCC[C@@H](NO)C(=O)O
InChIInChI=1S/C6H14N2O3/c7-4-2-1-3-5(8-11)6(9)10/h5,8,11H,1-4,7H2,(H,9,10)/t5-/m1/s1
InChIKeyQJHBJHUKURJDLG-RXMQYKEDSA-N
XLogP-0.45
TPSA95.58 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500162.19
LogP ≤ 5-0.45
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (2R)-6-amino-2-(hydroxyamino)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2S)-6-amino-2-(hydroxyamino)hexanoic acid;propanoic acid
CID 118384370
(2S)-6-amino-2-(deuteriooxyamino)hexanoic acid
CID 141398106
6-amino-2-(hydroxyamino)hexanoic acid;3-methyl-2-(methylamino)butanoic acid
CID 174469022
(2S)-6-amino-2-[(2-aminoacetyl)amino]hexanoic acid
CID 3080576
(2S)-6-amino-2-(3-oxobutanoylamino)hexanoic acid
CID 166492381
(2S)-6-amino-2-(methylamino)hexanoic acid;dihydrochloride
CID 22872767
6-amino-2-(hydroxymethylamino)hexanoic acid
CID 18519143
6-amino-2-(carboxymethylamino)hexanoic acid
CID 11680034
6-amino-2-(2-oxopropanoylamino)hexanoic acid
CID 87246065
(2S)-6-amino-2-(8-aminooctanoylamino)hexanoic acid
CID 118249963
6-amino-2-(6-aminohexanoylamino)hexanoic acid
CID 19028400
acetic acid;(2S)-6-amino-2-(ethylamino)hexanoic acid
CID 162326558

Frequently Asked Questions

What is the IUPAC name of (2R)-6-amino-2-(hydroxyamino)hexanoic acid?
The IUPAC name of (2R)-6-amino-2-(hydroxyamino)hexanoic acid (CID 87193141) is (2R)-6-amino-2-(hydroxyamino)hexanoic acid.
What is the SMILES notation for (2R)-6-amino-2-(hydroxyamino)hexanoic acid?
The canonical SMILES for (2R)-6-amino-2-(hydroxyamino)hexanoic acid is NCCCC[C@@H](NO)C(=O)O.
What is the InChIKey of (2R)-6-amino-2-(hydroxyamino)hexanoic acid?
The InChIKey is QJHBJHUKURJDLG-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H14N2O3/c7-4-2-1-3-5(8-11)6(9)10/h5,8,11H,1-4,7H2,(H,9,10)/t5-/m1/s1.
What are the key properties of (2R)-6-amino-2-(hydroxyamino)hexanoic acid?
(2R)-6-amino-2-(hydroxyamino)hexanoic acid has a molecular weight of 162.19 g/mol, XLogP of -0.45, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-6-amino-2-(hydroxyamino)hexanoic acid is sourced from PubChem (CID 87193141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).