C12H27N3O5 — CID 174469022
6-amino-2-(hydroxyamino)hexanoic acid;3-methyl-2-(methylamino)butanoic acid (PubChem CID 174469022) has the molecular formula C12H27N3O5 and a molecular weight of 293.36 g/mol. Its IUPAC name is 6-amino-2-(hydroxyamino)hexanoic acid;3-methyl-2-(methylamino)butanoic acid.
| Compound Name | 6-amino-2-(hydroxyamino)hexanoic acid;3-methyl-2-(methylamino)butanoic acid |
|---|---|
| PubChem CID | 174469022 |
| Molecular Formula | C12H27N3O5 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 6-amino-2-(hydroxyamino)hexanoic acid;3-methyl-2-(methylamino)butanoic acid |
| SMILES | CNC(C(=O)O)C(C)C.NCCCCC(NO)C(=O)O |
| InChI | InChI=1S/C6H14N2O3.C6H13NO2/c7-4-2-1-3-5(8-11)6(9)10;1-4(2)5(7-3)6(8)9/h5,8,11H,1-4,7H2,(H,9,10);4-5,7H,1-3H3,(H,8,9) |
| InChIKey | XRBUSFRAYUFELS-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 144.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|