C6H15ClN2O2 — CID 23216389
5-amino-2-(methylamino)pentanoic acid;hydrochloride (PubChem CID 23216389) has the molecular formula C6H15ClN2O2 and a molecular weight of 182.65 g/mol. Its IUPAC name is 5-amino-2-(methylamino)pentanoic acid;hydrochloride.
| Compound Name | 5-amino-2-(methylamino)pentanoic acid;hydrochloride |
|---|---|
| PubChem CID | 23216389 |
| Molecular Formula | C6H15ClN2O2 |
| Molecular Weight | 182.65 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 5-amino-2-(methylamino)pentanoic acid;hydrochloride |
| SMILES | CNC(CCCN)C(=O)O.Cl |
| InChI | InChI=1S/C6H14N2O2.ClH/c1-8-5(6(9)10)3-2-4-7;/h5,8H,2-4,7H2,1H3,(H,9,10);1H |
| InChIKey | OUPNMQRLBAANLP-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.65 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |