(2R)-5-amino-2-(ethylamino)pentanoic acid

C7H16N2O2 — CID 143752846

IUPAC(2R)-5-amino-2-(ethylamino)pentanoic acid
SMILESCCN[C@H](CCCN)C(=O)O
InChIInChI=1S/C7H16N2O2/c1-2-9-6(7(10)11)4-3-5-8/h6,9H,2-5,8H2,1H3,(H,10,11)/t6-/m1/s1
InChIKeyUMKHSOQAVNCWST-ZCFIWIBFSA-N
MW160.22 g/mol
LogP-0.21
Rot. Bonds6

About (2R)-5-amino-2-(ethylamino)pentanoic acid

(2R)-5-amino-2-(ethylamino)pentanoic acid (PubChem CID 143752846) has the molecular formula C7H16N2O2 and a molecular weight of 160.22 g/mol. Its IUPAC name is (2R)-5-amino-2-(ethylamino)pentanoic acid.

Molecular Properties

Compound Name(2R)-5-amino-2-(ethylamino)pentanoic acid
PubChem CID143752846
Molecular FormulaC7H16N2O2
Molecular Weight160.22 g/mol
Exact Mass160.12
IUPAC Name(2R)-5-amino-2-(ethylamino)pentanoic acid
SMILESCCN[C@H](CCCN)C(=O)O
InChIInChI=1S/C7H16N2O2/c1-2-9-6(7(10)11)4-3-5-8/h6,9H,2-5,8H2,1H3,(H,10,11)/t6-/m1/s1
InChIKeyUMKHSOQAVNCWST-ZCFIWIBFSA-N
XLogP-0.21
TPSA75.35 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.22
LogP ≤ 5-0.21
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (2R)-5-amino-2-(ethylamino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

6-amino-2-(ethylamino)hexanoic acid;dihydrochloride
CID 175594704
acetic acid;(2S)-6-amino-2-(ethylamino)hexanoic acid
CID 162326558
(2S)-4-amino-2-(ethylamino)butanoic acid
CID 89433986
(2R)-5-amino-2-(carboxymethylamino)pentanoic acid
CID 22810355
2-(ethylamino)hexanedioic acid
CID 88869975
(2S)-6-amino-2-(ethylamino)hexanamide
CID 90248692
(2S)-5-(carbamoylamino)-2-(ethylamino)pentanoic acid
CID 22864128
5-amino-2-(methylamino)pentanoic acid;hydrochloride
CID 23216389
8-amino-4-(ethylamino)octan-3-one
CID 20755672
5-amino-2-(6-aminohexylamino)pentanoic acid;trihydrochloride
CID 174056033
(2S)-5-amino-2-(propan-2-ylamino)pentanoic acid
CID 18639751
6-amino-2-(hydroxymethylamino)hexanoic acid
CID 18519143

Frequently Asked Questions

What is the IUPAC name of (2R)-5-amino-2-(ethylamino)pentanoic acid?
The IUPAC name of (2R)-5-amino-2-(ethylamino)pentanoic acid (CID 143752846) is (2R)-5-amino-2-(ethylamino)pentanoic acid.
What is the SMILES notation for (2R)-5-amino-2-(ethylamino)pentanoic acid?
The canonical SMILES for (2R)-5-amino-2-(ethylamino)pentanoic acid is CCN[C@H](CCCN)C(=O)O.
What is the InChIKey of (2R)-5-amino-2-(ethylamino)pentanoic acid?
The InChIKey is UMKHSOQAVNCWST-ZCFIWIBFSA-N. The full InChI is InChI=1S/C7H16N2O2/c1-2-9-6(7(10)11)4-3-5-8/h6,9H,2-5,8H2,1H3,(H,10,11)/t6-/m1/s1.
What are the key properties of (2R)-5-amino-2-(ethylamino)pentanoic acid?
(2R)-5-amino-2-(ethylamino)pentanoic acid has a molecular weight of 160.22 g/mol, XLogP of -0.21, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-5-amino-2-(ethylamino)pentanoic acid is sourced from PubChem (CID 143752846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).