(2R)-5-amino-2-(carboxymethylamino)pentanoic acid

C7H14N2O4 — CID 22810355

IUPAC(2R)-5-amino-2-(carboxymethylamino)pentanoic acid
SMILESNCCC[C@@H](NCC(=O)O)C(=O)O
InChIInChI=1S/C7H14N2O4/c8-3-1-2-5(7(12)13)9-4-6(10)11/h5,9H,1-4,8H2,(H,10,11)(H,12,13)/t5-/m1/s1
InChIKeyYVSBHPGVGNJMHM-RXMQYKEDSA-N
MW190.20 g/mol
LogP-1.15
Rot. Bonds7

About (2R)-5-amino-2-(carboxymethylamino)pentanoic acid

(2R)-5-amino-2-(carboxymethylamino)pentanoic acid (PubChem CID 22810355) has the molecular formula C7H14N2O4 and a molecular weight of 190.20 g/mol. Its IUPAC name is (2R)-5-amino-2-(carboxymethylamino)pentanoic acid.

Molecular Properties

Compound Name(2R)-5-amino-2-(carboxymethylamino)pentanoic acid
PubChem CID22810355
Molecular FormulaC7H14N2O4
Molecular Weight190.20 g/mol
Exact Mass190.10
IUPAC Name(2R)-5-amino-2-(carboxymethylamino)pentanoic acid
SMILESNCCC[C@@H](NCC(=O)O)C(=O)O
InChIInChI=1S/C7H14N2O4/c8-3-1-2-5(7(12)13)9-4-6(10)11/h5,9H,1-4,8H2,(H,10,11)(H,12,13)/t5-/m1/s1
InChIKeyYVSBHPGVGNJMHM-RXMQYKEDSA-N
XLogP-1.15
TPSA112.65 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.20
LogP ≤ 5-1.15
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze (2R)-5-amino-2-(carboxymethylamino)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

6-amino-2-(carboxymethylamino)hexanoic acid
CID 11680034
(2S)-6-amino-2-(carboxymethylamino)-4-deuteriohexanoic acid
CID 141336404
(2R)-5-amino-2-(ethylamino)pentanoic acid
CID 143752846
6-amino-2-(hydroxymethylamino)hexanoic acid
CID 18519143
5-amino-2-(6-aminohexylamino)pentanoic acid;trihydrochloride
CID 174056033
5-amino-2-(iodoamino)pentanoic acid
CID 146484863
(2R)-2-[(4-amino-1-carboxybutyl)amino]pentanedioic acid
CID 102061405
5-amino-2-(methylamino)pentanoic acid;hydrochloride
CID 23216389
6-amino-2-(ethylamino)hexanoic acid;dihydrochloride
CID 175594704
(2S)-6-amino-2-(4-carboxybutylamino)hexanoic acid
CID 164521049
(2R)-5-amino-2-formamidopentanoic acid
CID 174416809
(2S)-5-amino-2-(propan-2-ylamino)pentanoic acid
CID 18639751

Frequently Asked Questions

What is the IUPAC name of (2R)-5-amino-2-(carboxymethylamino)pentanoic acid?
The IUPAC name of (2R)-5-amino-2-(carboxymethylamino)pentanoic acid (CID 22810355) is (2R)-5-amino-2-(carboxymethylamino)pentanoic acid.
What is the SMILES notation for (2R)-5-amino-2-(carboxymethylamino)pentanoic acid?
The canonical SMILES for (2R)-5-amino-2-(carboxymethylamino)pentanoic acid is NCCC[C@@H](NCC(=O)O)C(=O)O.
What is the InChIKey of (2R)-5-amino-2-(carboxymethylamino)pentanoic acid?
The InChIKey is YVSBHPGVGNJMHM-RXMQYKEDSA-N. The full InChI is InChI=1S/C7H14N2O4/c8-3-1-2-5(7(12)13)9-4-6(10)11/h5,9H,1-4,8H2,(H,10,11)(H,12,13)/t5-/m1/s1.
What are the key properties of (2R)-5-amino-2-(carboxymethylamino)pentanoic acid?
(2R)-5-amino-2-(carboxymethylamino)pentanoic acid has a molecular weight of 190.20 g/mol, XLogP of -1.15, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-5-amino-2-(carboxymethylamino)pentanoic acid is sourced from PubChem (CID 22810355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).