(2R)-5-amino-2-formamidopentanoic acid

C6H12N2O3 — CID 174416809

IUPAC(2R)-5-amino-2-formamidopentanoic acid
SMILESNCCC[C@@H](NC=O)C(=O)O
InChIInChI=1S/C6H12N2O3/c7-3-1-2-5(6(10)11)8-4-9/h4-5H,1-3,7H2,(H,8,9)(H,10,11)/t5-/m1/s1
InChIKeyHASCYVPYQRPYDC-RXMQYKEDSA-N
MW160.17 g/mol
LogP-1.08
Rot. Bonds6

About (2R)-5-amino-2-formamidopentanoic acid

(2R)-5-amino-2-formamidopentanoic acid (PubChem CID 174416809) has the molecular formula C6H12N2O3 and a molecular weight of 160.17 g/mol. Its IUPAC name is (2R)-5-amino-2-formamidopentanoic acid.

Molecular Properties

Compound Name(2R)-5-amino-2-formamidopentanoic acid
PubChem CID174416809
Molecular FormulaC6H12N2O3
Molecular Weight160.17 g/mol
Exact Mass160.08
IUPAC Name(2R)-5-amino-2-formamidopentanoic acid
SMILESNCCC[C@@H](NC=O)C(=O)O
InChIInChI=1S/C6H12N2O3/c7-3-1-2-5(6(10)11)8-4-9/h4-5H,1-3,7H2,(H,8,9)(H,10,11)/t5-/m1/s1
InChIKeyHASCYVPYQRPYDC-RXMQYKEDSA-N
XLogP-1.08
TPSA92.42 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500160.17
LogP ≤ 5-1.08
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze (2R)-5-amino-2-formamidopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2S)-5-amino-2-(ethenylamino)pentanoic acid
CID 172797723
amino (2R)-5-amino-2-formamidopentanoate
CID 174668707
(2S)-5-amino-2-formamido-5-oxopentanoic acid
CID 2054353
5-amino-2-(iodoamino)pentanoic acid
CID 146484863
(2S)-6-amino-2-(prop-1-enylamino)hexanoic acid
CID 141276887
ethyl (2S)-6-amino-2-formamidohexanoate
CID 57231978
2-formamido-6-methoxyhexanoic acid
CID 104647734
(2R)-5-amino-2-(carboxymethylamino)pentanoic acid
CID 22810355
5-amino-2-(methylamino)pentanoic acid;hydrochloride
CID 23216389
3-aminopropanoic acid;2-formamido-4-methylsulfanylbutanoic acid
CID 174949821
(2R)-5-amino-2-(ethylamino)pentanoic acid
CID 143752846
(2S)-5-amino-2-(propan-2-ylamino)pentanoic acid
CID 18639751

Frequently Asked Questions

What is the IUPAC name of (2R)-5-amino-2-formamidopentanoic acid?
The IUPAC name of (2R)-5-amino-2-formamidopentanoic acid (CID 174416809) is (2R)-5-amino-2-formamidopentanoic acid.
What is the SMILES notation for (2R)-5-amino-2-formamidopentanoic acid?
The canonical SMILES for (2R)-5-amino-2-formamidopentanoic acid is NCCC[C@@H](NC=O)C(=O)O.
What is the InChIKey of (2R)-5-amino-2-formamidopentanoic acid?
The InChIKey is HASCYVPYQRPYDC-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H12N2O3/c7-3-1-2-5(6(10)11)8-4-9/h4-5H,1-3,7H2,(H,8,9)(H,10,11)/t5-/m1/s1.
What are the key properties of (2R)-5-amino-2-formamidopentanoic acid?
(2R)-5-amino-2-formamidopentanoic acid has a molecular weight of 160.17 g/mol, XLogP of -1.08, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-5-amino-2-formamidopentanoic acid is sourced from PubChem (CID 174416809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).