C6H10N2O4 — CID 2054353
(2S)-5-amino-2-formamido-5-oxopentanoic acid (PubChem CID 2054353) has the molecular formula C6H10N2O4 and a molecular weight of 174.16 g/mol. Its IUPAC name is (2S)-5-amino-2-formamido-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-formamido-5-oxopentanoic acid |
|---|---|
| PubChem CID | 2054353 |
| Molecular Formula | C6H10N2O4 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | (2S)-5-amino-2-formamido-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@H](NC=O)C(=O)O |
| InChI | InChI=1S/C6H10N2O4/c7-5(10)2-1-4(6(11)12)8-3-9/h3-4H,1-2H2,(H2,7,10)(H,8,9)(H,11,12)/t4-/m0/s1 |
| InChIKey | OGYYSMAGRWSNGI-BYPYZUCNSA-N |
| XLogP | -1.55 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|