(2R)-5-amino-2-(carboxyamino)-5-oxopentanoic acid

C6H10N2O5 — CID 150215384

IUPAC(2R)-5-amino-2-(carboxyamino)-5-oxopentanoic acid
SMILESNC(=O)CC[C@@H](NC(=O)O)C(=O)O
InChIInChI=1S/C6H10N2O5/c7-4(9)2-1-3(5(10)11)8-6(12)13/h3,8H,1-2H2,(H2,7,9)(H,10,11)(H,12,13)/t3-/m1/s1
InChIKeyFSJGGDNXBAWPGS-GSVOUGTGSA-N
MW190.16 g/mol
LogP-1.03
Rot. Bonds5

About (2R)-5-amino-2-(carboxyamino)-5-oxopentanoic acid

(2R)-5-amino-2-(carboxyamino)-5-oxopentanoic acid (PubChem CID 150215384) has the molecular formula C6H10N2O5 and a molecular weight of 190.16 g/mol. Its IUPAC name is (2R)-5-amino-2-(carboxyamino)-5-oxopentanoic acid.

Molecular Properties

Compound Name(2R)-5-amino-2-(carboxyamino)-5-oxopentanoic acid
PubChem CID150215384
Molecular FormulaC6H10N2O5
Molecular Weight190.16 g/mol
Exact Mass190.06
IUPAC Name(2R)-5-amino-2-(carboxyamino)-5-oxopentanoic acid
SMILESNC(=O)CC[C@@H](NC(=O)O)C(=O)O
InChIInChI=1S/C6H10N2O5/c7-4(9)2-1-3(5(10)11)8-6(12)13/h3,8H,1-2H2,(H2,7,9)(H,10,11)(H,12,13)/t3-/m1/s1
InChIKeyFSJGGDNXBAWPGS-GSVOUGTGSA-N
XLogP-1.03
TPSA129.72 Ų
H-Bond Donors4
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.16
LogP ≤ 5-1.03
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 103

Analyze (2R)-5-amino-2-(carboxyamino)-5-oxopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-5-amino-2-(carboxyamino)-5-oxopentanoic acid?
The IUPAC name of (2R)-5-amino-2-(carboxyamino)-5-oxopentanoic acid (CID 150215384) is (2R)-5-amino-2-(carboxyamino)-5-oxopentanoic acid.
What is the SMILES notation for (2R)-5-amino-2-(carboxyamino)-5-oxopentanoic acid?
The canonical SMILES for (2R)-5-amino-2-(carboxyamino)-5-oxopentanoic acid is NC(=O)CC[C@@H](NC(=O)O)C(=O)O.
What is the InChIKey of (2R)-5-amino-2-(carboxyamino)-5-oxopentanoic acid?
The InChIKey is FSJGGDNXBAWPGS-GSVOUGTGSA-N. The full InChI is InChI=1S/C6H10N2O5/c7-4(9)2-1-3(5(10)11)8-6(12)13/h3,8H,1-2H2,(H2,7,9)(H,10,11)(H,12,13)/t3-/m1/s1.
What are the key properties of (2R)-5-amino-2-(carboxyamino)-5-oxopentanoic acid?
(2R)-5-amino-2-(carboxyamino)-5-oxopentanoic acid has a molecular weight of 190.16 g/mol, XLogP of -1.03, 5 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-5-amino-2-(carboxyamino)-5-oxopentanoic acid is sourced from PubChem (CID 150215384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).