C10H21N3O4 — CID 178159244
(2S)-5-amino-2-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoic acid;ethane (PubChem CID 178159244) has the molecular formula C10H21N3O4 and a molecular weight of 247.29 g/mol. Its IUPAC name is (2S)-5-amino-2-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoic acid;ethane.
| Compound Name | (2S)-5-amino-2-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoic acid;ethane |
|---|---|
| PubChem CID | 178159244 |
| Molecular Formula | C10H21N3O4 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | (2S)-5-amino-2-[[(2S)-2-aminopropanoyl]amino]-5-oxopentanoic acid;ethane |
| SMILES | CC.C[C@H](N)C(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C8H15N3O4.C2H6/c1-4(9)7(13)11-5(8(14)15)2-3-6(10)12;1-2/h4-5H,2-3,9H2,1H3,(H2,10,12)(H,11,13)(H,14,15);1-2H3/t4-,5-;/m0./s1 |
| InChIKey | XLCDODQALLMJFZ-FHAQVOQBSA-N |
| XLogP | -0.81 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |