C8H15ClN2O5 — CID 88754532
(2R)-2-[[(2S)-2-aminopropanoyl]amino]pentanedioic acid;hydrochloride (PubChem CID 88754532) has the molecular formula C8H15ClN2O5 and a molecular weight of 254.67 g/mol. Its IUPAC name is (2R)-2-[[(2S)-2-aminopropanoyl]amino]pentanedioic acid;hydrochloride.
| Compound Name | (2R)-2-[[(2S)-2-aminopropanoyl]amino]pentanedioic acid;hydrochloride |
|---|---|
| PubChem CID | 88754532 |
| Molecular Formula | C8H15ClN2O5 |
| Molecular Weight | 254.67 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | (2R)-2-[[(2S)-2-aminopropanoyl]amino]pentanedioic acid;hydrochloride |
| SMILES | C[C@H](N)C(=O)N[C@H](CCC(=O)O)C(=O)O.Cl |
| InChI | InChI=1S/C8H14N2O5.ClH/c1-4(9)7(13)10-5(8(14)15)2-3-6(11)12;/h4-5H,2-3,9H2,1H3,(H,10,13)(H,11,12)(H,14,15);1H/t4-,5+;/m0./s1 |
| InChIKey | BHKILIWPLSUSAT-UYXJWNHNSA-N |
| XLogP | -0.81 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.67 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |