C11H19N3O6 — CID 18218343
4-(2-aminopropanoylamino)-5-(1-carboxyethylamino)-5-oxopentanoic acid (PubChem CID 18218343) has the molecular formula C11H19N3O6 and a molecular weight of 289.29 g/mol. Its IUPAC name is 4-(2-aminopropanoylamino)-5-(1-carboxyethylamino)-5-oxopentanoic acid.
| Compound Name | 4-(2-aminopropanoylamino)-5-(1-carboxyethylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18218343 |
| Molecular Formula | C11H19N3O6 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 4-(2-aminopropanoylamino)-5-(1-carboxyethylamino)-5-oxopentanoic acid |
| SMILES | CC(N)C(=O)NC(CCC(=O)O)C(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C11H19N3O6/c1-5(12)9(17)14-7(3-4-8(15)16)10(18)13-6(2)11(19)20/h5-7H,3-4,12H2,1-2H3,(H,13,18)(H,14,17)(H,15,16)(H,19,20) |
| InChIKey | FUSPCLTUKXQREV-UHFFFAOYSA-N |
| XLogP | -1.73 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |