C13H22N4O7 — CID 18218348
5-amino-2-[[2-(2-aminopropanoylamino)-4-carboxybutanoyl]amino]-5-oxopentanoic acid (PubChem CID 18218348) has the molecular formula C13H22N4O7 and a molecular weight of 346.34 g/mol. Its IUPAC name is 5-amino-2-[[2-(2-aminopropanoylamino)-4-carboxybutanoyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-(2-aminopropanoylamino)-4-carboxybutanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18218348 |
| Molecular Formula | C13H22N4O7 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 5-amino-2-[[2-(2-aminopropanoylamino)-4-carboxybutanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(N)C(=O)NC(CCC(=O)O)C(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C13H22N4O7/c1-6(14)11(21)16-7(3-5-10(19)20)12(22)17-8(13(23)24)2-4-9(15)18/h6-8H,2-5,14H2,1H3,(H2,15,18)(H,16,21)(H,17,22)(H,19,20)(H,23,24) |
| InChIKey | BGNLUHXLSAQYRQ-UHFFFAOYSA-N |
| XLogP | -2.48 |
| TPSA | 201.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |