C6H8NO6- — CID 102516015
(4S)-4-(carboxyamino)-5-hydroxy-5-oxopentanoate (PubChem CID 102516015) has the molecular formula C6H8NO6- and a molecular weight of 190.13 g/mol. Its IUPAC name is (4S)-4-(carboxyamino)-5-hydroxy-5-oxopentanoate.
| Compound Name | (4S)-4-(carboxyamino)-5-hydroxy-5-oxopentanoate |
|---|---|
| PubChem CID | 102516015 |
| Molecular Formula | C6H8NO6- |
| Molecular Weight | 190.13 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | (4S)-4-(carboxyamino)-5-hydroxy-5-oxopentanoate |
| SMILES | O=C([O-])CC[C@H](NC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H9NO6/c8-4(9)2-1-3(5(10)11)7-6(12)13/h3,7H,1-2H2,(H,8,9)(H,10,11)(H,12,13)/p-1/t3-/m0/s1 |
| InChIKey | YMBIICKZNSTXJA-VKHMYHEASA-M |
| XLogP | -1.76 |
| TPSA | 126.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.13 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |