C7H9NNa2O5 — CID 18539436
disodium;2-acetamidopentanedioate (PubChem CID 18539436) has the molecular formula C7H9NNa2O5 and a molecular weight of 233.13 g/mol. Its IUPAC name is disodium;2-acetamidopentanedioate.
| Compound Name | disodium;2-acetamidopentanedioate |
|---|---|
| PubChem CID | 18539436 |
| Molecular Formula | C7H9NNa2O5 |
| Molecular Weight | 233.13 g/mol |
| Exact Mass | 233.03 |
| IUPAC Name | disodium;2-acetamidopentanedioate |
| SMILES | CC(=O)NC(CCC(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C7H11NO5.2Na/c1-4(9)8-5(7(12)13)2-3-6(10)11;;/h5H,2-3H2,1H3,(H,8,9)(H,10,11)(H,12,13);;/q;2*+1/p-2 |
| InChIKey | AFCZRJZLTGNMDX-UHFFFAOYSA-L |
| XLogP | -9.22 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.13 |
| LogP ≤ 5 | -9.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |