C12H12Li4N2O10 — CID 162517555
tetralithium;(2S)-2-[[2-[[(1S)-1,3-dicarboxylatopropyl]amino]-2-oxoacetyl]amino]pentanedioate (PubChem CID 162517555) has the molecular formula C12H12Li4N2O10 and a molecular weight of 372.00 g/mol. Its IUPAC name is tetralithium;(2S)-2-[[2-[[(1S)-1,3-dicarboxylatopropyl]amino]-2-oxoacetyl]amino]pentanedioate.
| Compound Name | tetralithium;(2S)-2-[[2-[[(1S)-1,3-dicarboxylatopropyl]amino]-2-oxoacetyl]amino]pentanedioate |
|---|---|
| PubChem CID | 162517555 |
| Molecular Formula | C12H12Li4N2O10 |
| Molecular Weight | 372.00 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | tetralithium;(2S)-2-[[2-[[(1S)-1,3-dicarboxylatopropyl]amino]-2-oxoacetyl]amino]pentanedioate |
| SMILES | O=C([O-])CC[C@H](NC(=O)C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-])C(=O)[O-].[Li+].[Li+].[Li+].[Li+] |
| InChI | InChI=1S/C12H16N2O10.4Li/c15-7(16)3-1-5(11(21)22)13-9(19)10(20)14-6(12(23)24)2-4-8(17)18;;;;/h5-6H,1-4H2,(H,13,19)(H,14,20)(H,15,16)(H,17,18)(H,21,22)(H,23,24);;;;/q;4*+1/p-4/t5-,6-;;;;/m0..../s1 |
| InChIKey | PZOGNJVQPPISBA-UKVIHGRNSA-J |
| XLogP | -19.47 |
| TPSA | 218.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.00 |
| LogP ≤ 5 | -19.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|