C18H24CaN2O10 — CID 122611053
calcium bis((2S)-5-hydroxy-2-(2-methylprop-2-enoylamino)-5-oxopentanoate) (PubChem CID 122611053) has the molecular formula C18H24CaN2O10 and a molecular weight of 468.47 g/mol. Its IUPAC name is calcium bis((2S)-5-hydroxy-2-(2-methylprop-2-enoylamino)-5-oxopentanoate).
| Compound Name | calcium bis((2S)-5-hydroxy-2-(2-methylprop-2-enoylamino)-5-oxopentanoate) |
|---|---|
| PubChem CID | 122611053 |
| Molecular Formula | C18H24CaN2O10 |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | calcium bis((2S)-5-hydroxy-2-(2-methylprop-2-enoylamino)-5-oxopentanoate) |
| SMILES | C=C(C)C(=O)N[C@@H](CCC(=O)O)C(=O)[O-].C=C(C)C(=O)N[C@@H](CCC(=O)O)C(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C9H13NO5.Ca/c2*1-5(2)8(13)10-6(9(14)15)3-4-7(11)12;/h2*6H,1,3-4H2,2H3,(H,10,13)(H,11,12)(H,14,15);/q;;+2/p-2/t2*6-;/m00./s1 |
| InChIKey | LYMVEMAEQRTVJQ-UAIGZDOSSA-L |
| XLogP | -3.06 |
| TPSA | 213.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | -3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|