C8H10KNO5 — CID 122612104
potassium (2S)-4-hydroxy-2-(2-methylprop-2-enoylamino)-4-oxobutanoate (PubChem CID 122612104) has the molecular formula C8H10KNO5 and a molecular weight of 239.27 g/mol. Its IUPAC name is potassium (2S)-4-hydroxy-2-(2-methylprop-2-enoylamino)-4-oxobutanoate.
| Compound Name | potassium (2S)-4-hydroxy-2-(2-methylprop-2-enoylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 122612104 |
| Molecular Formula | C8H10KNO5 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.02 |
| IUPAC Name | potassium (2S)-4-hydroxy-2-(2-methylprop-2-enoylamino)-4-oxobutanoate |
| SMILES | C=C(C)C(=O)N[C@@H](CC(=O)O)C(=O)[O-].[K+] |
| InChI | InChI=1S/C8H11NO5.K/c1-4(2)7(12)9-5(8(13)14)3-6(10)11;/h5H,1,3H2,2H3,(H,9,12)(H,10,11)(H,13,14);/q;+1/p-1/t5-;/m0./s1 |
| InChIKey | AAFZXXUDGPZLCK-JEDNCBNOSA-M |
| XLogP | -4.72 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | -4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|