C6H11NO3 — CID 88801162
N-(1,2-dihydroxyethyl)-2-methylprop-2-enamide (PubChem CID 88801162) has the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. Its IUPAC name is N-(1,2-dihydroxyethyl)-2-methylprop-2-enamide.
| Compound Name | N-(1,2-dihydroxyethyl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 88801162 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | N-(1,2-dihydroxyethyl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)NC(O)CO |
| InChI | InChI=1S/C6H11NO3/c1-4(2)6(10)7-5(9)3-8/h5,8-9H,1,3H2,2H3,(H,7,10) |
| InChIKey | DIYYXNGGARQRFF-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|