C12H25ClN2O3 — CID 88595619
[2,3-dihydroxy-1-(2-methylprop-2-enoylamino)propyl]-dimethyl-propylazanium chloride (PubChem CID 88595619) has the molecular formula C12H25ClN2O3 and a molecular weight of 280.80 g/mol. Its IUPAC name is [2,3-dihydroxy-1-(2-methylprop-2-enoylamino)propyl]-dimethyl-propylazanium chloride.
| Compound Name | [2,3-dihydroxy-1-(2-methylprop-2-enoylamino)propyl]-dimethyl-propylazanium chloride |
|---|---|
| PubChem CID | 88595619 |
| Molecular Formula | C12H25ClN2O3 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | [2,3-dihydroxy-1-(2-methylprop-2-enoylamino)propyl]-dimethyl-propylazanium chloride |
| SMILES | C=C(C)C(=O)NC(C(O)CO)[N+](C)(C)CCC.[Cl-] |
| InChI | InChI=1S/C12H24N2O3.ClH/c1-6-7-14(4,5)11(10(16)8-15)13-12(17)9(2)3;/h10-11,15-16H,2,6-8H2,1,3-5H3;1H |
| InChIKey | DIFMDXAAJRHKMV-UHFFFAOYSA-N |
| XLogP | -3.15 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | -3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|