C17H34N2O4S — CID 134346514
3-[3-(2-methylprop-2-enoylamino)butyl-dipropylazaniumyl]propane-1-sulfonate (PubChem CID 134346514) has the molecular formula C17H34N2O4S and a molecular weight of 362.54 g/mol. Its IUPAC name is 3-[3-(2-methylprop-2-enoylamino)butyl-dipropylazaniumyl]propane-1-sulfonate.
| Compound Name | 3-[3-(2-methylprop-2-enoylamino)butyl-dipropylazaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 134346514 |
| Molecular Formula | C17H34N2O4S |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | 3-[3-(2-methylprop-2-enoylamino)butyl-dipropylazaniumyl]propane-1-sulfonate |
| SMILES | C=C(C)C(=O)NC(C)CC[N+](CCC)(CCC)CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C17H34N2O4S/c1-6-10-19(11-7-2,12-8-14-24(21,22)23)13-9-16(5)18-17(20)15(3)4/h16H,3,6-14H2,1-2,4-5H3,(H-,18,20,21,22,23) |
| InChIKey | YLOWSEMLSWOCGJ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|