C14H28N2O4S — CID 134346443
3-[(2-methylprop-2-enoylamino)methyl-dipropylazaniumyl]propane-1-sulfonate (PubChem CID 134346443) has the molecular formula C14H28N2O4S and a molecular weight of 320.46 g/mol. Its IUPAC name is 3-[(2-methylprop-2-enoylamino)methyl-dipropylazaniumyl]propane-1-sulfonate.
| Compound Name | 3-[(2-methylprop-2-enoylamino)methyl-dipropylazaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 134346443 |
| Molecular Formula | C14H28N2O4S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 3-[(2-methylprop-2-enoylamino)methyl-dipropylazaniumyl]propane-1-sulfonate |
| SMILES | C=C(C)C(=O)NC[N+](CCC)(CCC)CCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C14H28N2O4S/c1-5-8-16(9-6-2,10-7-11-21(18,19)20)12-15-14(17)13(3)4/h3,5-12H2,1-2,4H3,(H-,15,17,18,19,20) |
| InChIKey | HIGWMNJNSYFKOE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|