About 3-[bis(prop-2-enyl)-propylazaniumyl]propane-1-sulfonate;carbon dioxide
3-[bis(prop-2-enyl)-propylazaniumyl]propane-1-sulfonate;carbon dioxide (PubChem CID 160517327) has the molecular formula C13H23NO5S
and a molecular weight of 305.40 g/mol. Its IUPAC name is 3-[bis(prop-2-enyl)-propylazaniumyl]propane-1-sulfonate;carbon dioxide.
Molecular Properties
| Compound Name | 3-[bis(prop-2-enyl)-propylazaniumyl]propane-1-sulfonate;carbon dioxide |
| PubChem CID | 160517327 |
| Molecular Formula | C13H23NO5S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 3-[bis(prop-2-enyl)-propylazaniumyl]propane-1-sulfonate;carbon dioxide |
| SMILES | C=CC[N+](CC=C)(CCC)CCCS(=O)(=O)[O-].O=C=O |
| InChI | InChI=1S/C12H23NO3S.CO2/c1-4-8-13(9-5-2,10-6-3)11-7-12-17(14,15)16;2-1-3/h4-5H,1-2,6-12H2,3H3; |
| InChIKey | QTUZXBFKZJKNDV-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 91.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[bis(prop-2-enyl)-propylazaniumyl]propane-1-sulfonate;carbon dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[bis(prop-2-enyl)-propylazaniumyl]propane-1-sulfonate;carbon dioxide?
The IUPAC name of 3-[bis(prop-2-enyl)-propylazaniumyl]propane-1-sulfonate;carbon dioxide (CID 160517327) is 3-[bis(prop-2-enyl)-propylazaniumyl]propane-1-sulfonate;carbon dioxide.
What is the SMILES notation for 3-[bis(prop-2-enyl)-propylazaniumyl]propane-1-sulfonate;carbon dioxide?
The canonical SMILES for 3-[bis(prop-2-enyl)-propylazaniumyl]propane-1-sulfonate;carbon dioxide is C=CC[N+](CC=C)(CCC)CCCS(=O)(=O)[O-].O=C=O.
What is the InChIKey of 3-[bis(prop-2-enyl)-propylazaniumyl]propane-1-sulfonate;carbon dioxide?
The InChIKey is QTUZXBFKZJKNDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3S.CO2/c1-4-8-13(9-5-2,10-6-3)11-7-12-17(14,15)16;2-1-3/h4-5H,1-2,6-12H2,3H3;.
What are the key properties of 3-[bis(prop-2-enyl)-propylazaniumyl]propane-1-sulfonate;carbon dioxide?
3-[bis(prop-2-enyl)-propylazaniumyl]propane-1-sulfonate;carbon dioxide has a molecular weight of 305.40 g/mol, XLogP of 0.94, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[bis(prop-2-enyl)-propylazaniumyl]propane-1-sulfonate;carbon dioxide is sourced from PubChem (CID 160517327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).