C20H44N2O4S — CID 89051576
decane-1-sulfonate;2-methylprop-2-enamide;trimethyl(propyl)azanium (PubChem CID 89051576) has the molecular formula C20H44N2O4S and a molecular weight of 408.65 g/mol. Its IUPAC name is decane-1-sulfonate;2-methylprop-2-enamide;trimethyl(propyl)azanium.
| Compound Name | decane-1-sulfonate;2-methylprop-2-enamide;trimethyl(propyl)azanium |
|---|---|
| PubChem CID | 89051576 |
| Molecular Formula | C20H44N2O4S |
| Molecular Weight | 408.65 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | decane-1-sulfonate;2-methylprop-2-enamide;trimethyl(propyl)azanium |
| SMILES | C=C(C)C(N)=O.CCCCCCCCCCS(=O)(=O)[O-].CCC[N+](C)(C)C |
| InChI | InChI=1S/C10H22O3S.C6H16N.C4H7NO/c1-2-3-4-5-6-7-8-9-10-14(11,12)13;1-5-6-7(2,3)4;1-3(2)4(5)6/h2-10H2,1H3,(H,11,12,13);5-6H2,1-4H3;1H2,2H3,(H2,5,6)/q;+1;/p-1 |
| InChIKey | ONHXAPYDMVVMJT-UHFFFAOYSA-M |
| XLogP | 3.82 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.65 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|