C10H24N2O2 — CID 23175266
2-methylprop-2-enamide;trimethyl(propyl)azanium;hydroxide (PubChem CID 23175266) has the molecular formula C10H24N2O2 and a molecular weight of 204.31 g/mol. Its IUPAC name is 2-methylprop-2-enamide;trimethyl(propyl)azanium;hydroxide.
| Compound Name | 2-methylprop-2-enamide;trimethyl(propyl)azanium;hydroxide |
|---|---|
| PubChem CID | 23175266 |
| Molecular Formula | C10H24N2O2 |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.18 |
| IUPAC Name | 2-methylprop-2-enamide;trimethyl(propyl)azanium;hydroxide |
| SMILES | C=C(C)C(N)=O.CCC[N+](C)(C)C.[OH-] |
| InChI | InChI=1S/C6H16N.C4H7NO.H2O/c1-5-6-7(2,3)4;1-3(2)4(5)6;/h5-6H2,1-4H3;1H2,2H3,(H2,5,6);1H2/q+1;;/p-1 |
| InChIKey | VUMVLSGIOPWJBB-UHFFFAOYSA-M |
| XLogP | 0.97 |
| TPSA | 73.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|